Product Name: HPEG 2400 (flakes)
CAS Number: 31497-33-3
Molecular Formula: CH2=C(CH3)CH2O(CH2CH2O)nH
HPEG (polycarboxylate ether monomer) is the primary raw material (polycarboxylate ether monomer) for the production of a highly effective polycarboxylate superplasticizer that reduces water absorption and maintains concrete slump. It is produced using methallyl alcohol and ethylene epoxide as the primary raw materials.
| Parameter | Specification | Test Method | Result |
| Appearance | Milky white in the light
yellow flaky solid |
Visual | Corresponds |
| Color and shine | 50#(APHA) | Visual | Corresponds |
| Molecular weight 2300-2500 | Yes | Civil law contract | 2380 Yes |
| Hydroxyl value (mg KOH/g) | 44.0-48.0 | ASTM D4274 | 46.2 |
| Double bond content (mmol/g) | 0.35 | Iodometric titration | 0.38 |
| Melting point ( ℃ ) | 50-55 | DSK | 52 |
| Water content (%)
|
0.5 | Karl Fischer | 0.22 |
| Ash content (%) | 0.1 | GB/T 7531 | 0.05 |
| Parameter | Specification | Test Method | Result |
| Appearance | Milky white in the light
yellow flaky solid |
Visual | Corresponds |
| Color and shine | 50#(APHA) | Visual | Corresponds |
| Molecular weight 2300-2500 | Yes | Civil law contract | 2380 Yes |
| Hydroxyl value (mg KOH/g) | 44.0-48.0 | ASTM D4274 | 46.2 |
| Double bond content (mmol/g) | 0.35 | Iodometric titration | 0.38 |
| Melting point ( ℃ ) | 50-55 | DSK | 52 |
| Water content (%)
|
0.5 | Karl Fischer | 0.22 |
| Ash content (%) | 0.1 | GB/T 7531 | 0.05 |
Product Name: HPEG 2400 (flakes)
CAS Number: 31497-33-3
Molecular Formula: CH2=C(CH3)CH2O(CH2CH2O)nH
HPEG (polycarboxylate ether monomer) is the primary raw material (polycarboxylate ether monomer) for the production of a highly effective polycarboxylate superplasticizer that reduces water absorption and maintains concrete slump. It is produced using methallyl alcohol and ethylene epoxide as the primary raw materials.
